C22H23ClN2O2S — CID 18512087
N-[3-[benzyl-[(2-chlorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide (PubChem CID 18512087) has the molecular formula C22H23ClN2O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is N-[3-[benzyl-[(2-chlorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[3-[benzyl-[(2-chlorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18512087 |
| Molecular Formula | C22H23ClN2O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[3-[benzyl-[(2-chlorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN2O2S/c1-17-21(24-28(2,26)27)13-8-14-22(17)25(15-18-9-4-3-5-10-18)16-19-11-6-7-12-20(19)23/h3-14,24H,15-16H2,1-2H3 |
| InChIKey | HGUAVYAPBJPMFL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |