About N',N'-diethylmethanediamine
N',N'-diethylmethanediamine (PubChem CID 18512508) has the molecular formula C5H14N2
and a molecular weight of 102.18 g/mol. Its IUPAC name is N',N'-diethylmethanediamine.
Molecular Properties
| Compound Name | N',N'-diethylmethanediamine |
| PubChem CID | 18512508 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | N',N'-diethylmethanediamine |
| SMILES | CCN(CC)CN |
| InChI | InChI=1S/C5H14N2/c1-3-7(4-2)5-6/h3-6H2,1-2H3 |
| InChIKey | SLBGBYOQCVAHBC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethylmethanediamine?
The IUPAC name of N',N'-diethylmethanediamine (CID 18512508) is N',N'-diethylmethanediamine.
What is the SMILES notation for N',N'-diethylmethanediamine?
The canonical SMILES for N',N'-diethylmethanediamine is CCN(CC)CN.
What is the InChIKey of N',N'-diethylmethanediamine?
The InChIKey is SLBGBYOQCVAHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2/c1-3-7(4-2)5-6/h3-6H2,1-2H3.
What are the key properties of N',N'-diethylmethanediamine?
N',N'-diethylmethanediamine has a molecular weight of 102.18 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethylmethanediamine is sourced from PubChem (CID 18512508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).