About 2-sulfamoylbenzamide
2-sulfamoylbenzamide (PubChem CID 18513146) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-sulfamoylbenzamide.
Molecular Properties
| Compound Name | 2-sulfamoylbenzamide |
| PubChem CID | 18513146 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-sulfamoylbenzamide |
| SMILES | NC(=O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C7H8N2O3S/c8-7(10)5-3-1-2-4-6(5)13(9,11)12/h1-4H,(H2,8,10)(H2,9,11,12) |
| InChIKey | MXBLZLWZAHUKLU-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfamoylbenzamide?
The IUPAC name of 2-sulfamoylbenzamide (CID 18513146) is 2-sulfamoylbenzamide.
What is the SMILES notation for 2-sulfamoylbenzamide?
The canonical SMILES for 2-sulfamoylbenzamide is NC(=O)c1ccccc1S(N)(=O)=O.
What is the InChIKey of 2-sulfamoylbenzamide?
The InChIKey is MXBLZLWZAHUKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S/c8-7(10)5-3-1-2-4-6(5)13(9,11)12/h1-4H,(H2,8,10)(H2,9,11,12).
What are the key properties of 2-sulfamoylbenzamide?
2-sulfamoylbenzamide has a molecular weight of 200.22 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfamoylbenzamide is sourced from PubChem (CID 18513146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).