About propan-1-ol;propan-2-one
propan-1-ol;propan-2-one (PubChem CID 18513402) has the molecular formula C6H14O2
and a molecular weight of 118.18 g/mol. Its IUPAC name is propan-1-ol;propan-2-one.
Molecular Properties
| Compound Name | propan-1-ol;propan-2-one |
| PubChem CID | 18513402 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | propan-1-ol;propan-2-one |
| SMILES | CC(C)=O.CCCO |
| InChI | InChI=1S/C3H6O.C3H8O/c1-3(2)4;1-2-3-4/h1-2H3;4H,2-3H2,1H3 |
| InChIKey | QQOFJYQTBCFNNT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-1-ol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-1-ol;propan-2-one?
The IUPAC name of propan-1-ol;propan-2-one (CID 18513402) is propan-1-ol;propan-2-one.
What is the SMILES notation for propan-1-ol;propan-2-one?
The canonical SMILES for propan-1-ol;propan-2-one is CC(C)=O.CCCO.
What is the InChIKey of propan-1-ol;propan-2-one?
The InChIKey is QQOFJYQTBCFNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C3H8O/c1-3(2)4;1-2-3-4/h1-2H3;4H,2-3H2,1H3.
What are the key properties of propan-1-ol;propan-2-one?
propan-1-ol;propan-2-one has a molecular weight of 118.18 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-1-ol;propan-2-one is sourced from PubChem (CID 18513402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).