C18H18N2O6 — CID 18514
1,4-dihydroxy-5,8-bis(2-hydroxyethylamino)anthracene-9,10-dione (PubChem CID 18514) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is 1,4-dihydroxy-5,8-bis(2-hydroxyethylamino)anthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-5,8-bis(2-hydroxyethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 18514 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1,4-dihydroxy-5,8-bis(2-hydroxyethylamino)anthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCO)ccc(NCCO)c21 |
| InChI | InChI=1S/C18H18N2O6/c21-7-5-19-9-1-2-10(20-6-8-22)14-13(9)17(25)15-11(23)3-4-12(24)16(15)18(14)26/h1-4,19-24H,5-8H2 |
| InChIKey | WHPNHQRWWMLKPJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|