C23H23LiOP+ — CID 18515081
lithium (2-phenylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone (PubChem CID 18515081) has the molecular formula C23H23LiOP+ and a molecular weight of 353.35 g/mol. Its IUPAC name is lithium (2-phenylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone.
| Compound Name | lithium (2-phenylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 18515081 |
| Molecular Formula | C23H23LiOP+ |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | lithium (2-phenylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)Pc2ccccc2-c2ccccc2)c(C)c1C.[Li+] |
| InChI | InChI=1S/C23H23OP.Li/c1-15-14-16(2)22(18(4)17(15)3)23(24)25-21-13-9-8-12-20(21)19-10-6-5-7-11-19;/h5-14,25H,1-4H3;/q;+1 |
| InChIKey | LOQIZKLMHGDYGW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|