About 10H-phenoxazin-3-ol
10H-phenoxazin-3-ol (PubChem CID 18515401) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is 10H-phenoxazin-3-ol.
Molecular Properties
| Compound Name | 10H-phenoxazin-3-ol |
| PubChem CID | 18515401 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 10H-phenoxazin-3-ol |
| SMILES | Oc1ccc2c(c1)Oc1ccccc1N2 |
| InChI | InChI=1S/C12H9NO2/c14-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)13-10/h1-7,13-14H |
| InChIKey | RSGFNANUFQKTKV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenoxazin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenoxazin-3-ol?
The IUPAC name of 10H-phenoxazin-3-ol (CID 18515401) is 10H-phenoxazin-3-ol.
What is the SMILES notation for 10H-phenoxazin-3-ol?
The canonical SMILES for 10H-phenoxazin-3-ol is Oc1ccc2c(c1)Oc1ccccc1N2.
What is the InChIKey of 10H-phenoxazin-3-ol?
The InChIKey is RSGFNANUFQKTKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c14-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)13-10/h1-7,13-14H.
What are the key properties of 10H-phenoxazin-3-ol?
10H-phenoxazin-3-ol has a molecular weight of 199.21 g/mol, XLogP of 3.24, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenoxazin-3-ol is sourced from PubChem (CID 18515401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).