C20H27FN2O3 — CID 18516373
tert-butyl 2-[2-(3a-fluoro-4-oxo-2,3,5,9b-tetrahydro-1H-cyclopenta[c]quinolin-7-yl)ethylamino]acetate (PubChem CID 18516373) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is tert-butyl 2-[2-(3a-fluoro-4-oxo-2,3,5,9b-tetrahydro-1H-cyclopenta[c]quinolin-7-yl)ethylamino]acetate.
| Compound Name | tert-butyl 2-[2-(3a-fluoro-4-oxo-2,3,5,9b-tetrahydro-1H-cyclopenta[c]quinolin-7-yl)ethylamino]acetate |
|---|---|
| PubChem CID | 18516373 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | tert-butyl 2-[2-(3a-fluoro-4-oxo-2,3,5,9b-tetrahydro-1H-cyclopenta[c]quinolin-7-yl)ethylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNCCc1ccc2c(c1)NC(=O)C1(F)CCCC21 |
| InChI | InChI=1S/C20H27FN2O3/c1-19(2,3)26-17(24)12-22-10-8-13-6-7-14-15-5-4-9-20(15,21)18(25)23-16(14)11-13/h6-7,11,15,22H,4-5,8-10,12H2,1-3H3,(H,23,25) |
| InChIKey | IOUSGEXJVMGIDI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|