About 2,3-dihydro-1H-indene;propan-1-amine
2,3-dihydro-1H-indene;propan-1-amine (PubChem CID 18516594) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene;propan-1-amine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indene;propan-1-amine |
| PubChem CID | 18516594 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2,3-dihydro-1H-indene;propan-1-amine |
| SMILES | CCCN.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10.C3H9N/c1-2-5-9-7-3-6-8(9)4-1;1-2-3-4/h1-2,4-5H,3,6-7H2;2-4H2,1H3 |
| InChIKey | TVKDTBPAGHRUBR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydro-1H-indene;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indene;propan-1-amine?
The IUPAC name of 2,3-dihydro-1H-indene;propan-1-amine (CID 18516594) is 2,3-dihydro-1H-indene;propan-1-amine.
What is the SMILES notation for 2,3-dihydro-1H-indene;propan-1-amine?
The canonical SMILES for 2,3-dihydro-1H-indene;propan-1-amine is CCCN.c1ccc2c(c1)CCC2.
What is the InChIKey of 2,3-dihydro-1H-indene;propan-1-amine?
The InChIKey is TVKDTBPAGHRUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C3H9N/c1-2-5-9-7-3-6-8(9)4-1;1-2-3-4/h1-2,4-5H,3,6-7H2;2-4H2,1H3.
What are the key properties of 2,3-dihydro-1H-indene;propan-1-amine?
2,3-dihydro-1H-indene;propan-1-amine has a molecular weight of 177.29 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indene;propan-1-amine is sourced from PubChem (CID 18516594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).