About tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate
tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate (PubChem CID 18516851) has the molecular formula C25H25F2N5O2
and a molecular weight of 465.50 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate |
| PubChem CID | 18516851 |
| Molecular Formula | C25H25F2N5O2 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)c1ccc(-c2nc(Nc3ccc(F)c(F)c3)ncc2C#N)cc1 |
| InChI | InChI=1S/C25H25F2N5O2/c1-24(2,3)34-23(33)32-25(4,5)17-8-6-15(7-9-17)21-16(13-28)14-29-22(31-21)30-18-10-11-19(26)20(27)12-18/h6-12,14H,1-5H3,(H,32,33)(H,29,30,31) |
| InChIKey | SDXVESXRYSRJET-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate (CID 18516851) is tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate is CC(C)(C)OC(=O)NC(C)(C)c1ccc(-c2nc(Nc3ccc(F)c(F)c3)ncc2C#N)cc1.
What is the InChIKey of tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate?
The InChIKey is SDXVESXRYSRJET-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25F2N5O2/c1-24(2,3)34-23(33)32-25(4,5)17-8-6-15(7-9-17)21-16(13-28)14-29-22(31-21)30-18-10-11-19(26)20(27)12-18/h6-12,14H,1-5H3,(H,32,33)(H,29,30,31).
What are the key properties of tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate?
tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate has a molecular weight of 465.50 g/mol, XLogP of 5.80, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-[5-cyano-2-(3,4-difluoroanilino)pyrimidin-4-yl]phenyl]propan-2-yl]carbamate is sourced from PubChem (CID 18516851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).