About dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite
dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite (PubChem CID 18517202) has the molecular formula C6H18O10P4
and a molecular weight of 374.10 g/mol. Its IUPAC name is dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite.
Molecular Properties
| Compound Name | dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite |
| PubChem CID | 18517202 |
| Molecular Formula | C6H18O10P4 |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite |
| SMILES | CCC(CC)(COP(O)OP(O)O)OP(O)OP(O)O |
| InChI | InChI=1S/C6H18O10P4/c1-3-6(4-2,14-20(12)16-18(9)10)5-13-19(11)15-17(7)8/h7-12H,3-5H2,1-2H3 |
| InChIKey | RDRVRGZWGOZDNW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite?
The IUPAC name of dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite (CID 18517202) is dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite.
What is the SMILES notation for dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite?
The canonical SMILES for dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite is CCC(CC)(COP(O)OP(O)O)OP(O)OP(O)O.
What is the InChIKey of dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite?
The InChIKey is RDRVRGZWGOZDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18O10P4/c1-3-6(4-2,14-20(12)16-18(9)10)5-13-19(11)15-17(7)8/h7-12H,3-5H2,1-2H3.
What are the key properties of dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite?
dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite has a molecular weight of 374.10 g/mol, XLogP of 1.47, 11 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxyphosphanyl [2-[dihydroxyphosphanyloxy(hydroxy)phosphanyl]oxy-2-ethylbutyl] hydrogen phosphite is sourced from PubChem (CID 18517202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).