C17H25N5O6 — CID 18517251
2-[13-amino-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid (PubChem CID 18517251) has the molecular formula C17H25N5O6 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[13-amino-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid.
| Compound Name | 2-[13-amino-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
|---|---|
| PubChem CID | 18517251 |
| Molecular Formula | C17H25N5O6 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[13-amino-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
| SMILES | Nc1cc2nc(c1)CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)C2 |
| InChI | InChI=1S/C17H25N5O6/c18-12-5-13-7-21(10-16(25)26)3-1-20(9-15(23)24)2-4-22(11-17(27)28)8-14(6-12)19-13/h5-6H,1-4,7-11H2,(H2,18,19)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | JJGXUTHSGQLPTK-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |