About 2-chloro-2-fluoroethanol
2-chloro-2-fluoroethanol (PubChem CID 18517415) has the molecular formula C2H4ClFO
and a molecular weight of 98.50 g/mol. Its IUPAC name is 2-chloro-2-fluoroethanol.
Molecular Properties
| Compound Name | 2-chloro-2-fluoroethanol |
| PubChem CID | 18517415 |
| Molecular Formula | C2H4ClFO |
| Molecular Weight | 98.50 g/mol |
| Exact Mass | 97.99 |
| IUPAC Name | 2-chloro-2-fluoroethanol |
| SMILES | OCC(F)Cl |
| InChI | InChI=1S/C2H4ClFO/c3-2(4)1-5/h2,5H,1H2 |
| InChIKey | LRACLFFCXOEWLG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-fluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-fluoroethanol?
The IUPAC name of 2-chloro-2-fluoroethanol (CID 18517415) is 2-chloro-2-fluoroethanol.
What is the SMILES notation for 2-chloro-2-fluoroethanol?
The canonical SMILES for 2-chloro-2-fluoroethanol is OCC(F)Cl.
What is the InChIKey of 2-chloro-2-fluoroethanol?
The InChIKey is LRACLFFCXOEWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClFO/c3-2(4)1-5/h2,5H,1H2.
What are the key properties of 2-chloro-2-fluoroethanol?
2-chloro-2-fluoroethanol has a molecular weight of 98.50 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-fluoroethanol is sourced from PubChem (CID 18517415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).