C20H22FNO3 — CID 18518347
2-[13-[(dimethylamino)methyl]-5-fluoro-14-hydroxy-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetic acid (PubChem CID 18518347) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[13-[(dimethylamino)methyl]-5-fluoro-14-hydroxy-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetic acid.
| Compound Name | 2-[13-[(dimethylamino)methyl]-5-fluoro-14-hydroxy-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetic acid |
|---|---|
| PubChem CID | 18518347 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[13-[(dimethylamino)methyl]-5-fluoro-14-hydroxy-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]acetic acid |
| SMILES | CN(C)Cc1cc2c(cc1O)Cc1cc(F)ccc1C(CC(=O)O)C2 |
| InChI | InChI=1S/C20H22FNO3/c1-22(2)11-16-7-12-5-15(10-20(24)25)18-4-3-17(21)8-14(18)6-13(12)9-19(16)23/h3-4,7-9,15,23H,5-6,10-11H2,1-2H3,(H,24,25) |
| InChIKey | QPNXAAMWVRCYNZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|