About 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea
1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea (PubChem CID 18518478) has the molecular formula C8H10N4O4
and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea.
Molecular Properties
| Compound Name | 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea |
| PubChem CID | 18518478 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea |
| SMILES | [H]/N=C(\N)N(C(N)=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C8H10N4O4/c9-7(10)12(8(11)16)3-1-4(13)6(15)5(14)2-3/h1-2,13-15H,(H3,9,10)(H2,11,16) |
| InChIKey | VVHCRVYPQILSEA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea?
The IUPAC name of 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea (CID 18518478) is 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea.
What is the SMILES notation for 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea?
The canonical SMILES for 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea is [H]/N=C(\N)N(C(N)=O)c1cc(O)c(O)c(O)c1.
What is the InChIKey of 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea?
The InChIKey is VVHCRVYPQILSEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O4/c9-7(10)12(8(11)16)3-1-4(13)6(15)5(14)2-3/h1-2,13-15H,(H3,9,10)(H2,11,16).
What are the key properties of 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea?
1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea has a molecular weight of 226.19 g/mol, XLogP of -0.42, 1 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-1-(3,4,5-trihydroxyphenyl)urea is sourced from PubChem (CID 18518478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).