About 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine
2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine (PubChem CID 18518935) has the molecular formula C15H22ClNO
and a molecular weight of 267.80 g/mol. Its IUPAC name is 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine |
| PubChem CID | 18518935 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine |
| SMILES | CC(C)(C)N1OC(c2ccc(Cl)cc2)CC1(C)C |
| InChI | InChI=1S/C15H22ClNO/c1-14(2,3)17-15(4,5)10-13(18-17)11-6-8-12(16)9-7-11/h6-9,13H,10H2,1-5H3 |
| InChIKey | STUXRVSTXIDRNL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine?
The IUPAC name of 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine (CID 18518935) is 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine.
What is the SMILES notation for 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine?
The canonical SMILES for 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine is CC(C)(C)N1OC(c2ccc(Cl)cc2)CC1(C)C.
What is the InChIKey of 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine?
The InChIKey is STUXRVSTXIDRNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClNO/c1-14(2,3)17-15(4,5)10-13(18-17)11-6-8-12(16)9-7-11/h6-9,13H,10H2,1-5H3.
What are the key properties of 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine?
2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine has a molecular weight of 267.80 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(4-chlorophenyl)-3,3-dimethyl-1,2-oxazolidine is sourced from PubChem (CID 18518935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).