C13H12F3NO3 — CID 18519074
N-(5-ethoxy-3-oxo-1,2-dihydroinden-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 18519074) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is N-(5-ethoxy-3-oxo-1,2-dihydroinden-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(5-ethoxy-3-oxo-1,2-dihydroinden-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 18519074 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-(5-ethoxy-3-oxo-1,2-dihydroinden-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | CCOc1ccc2c(c1)C(=O)C(NC(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C13H12F3NO3/c1-2-20-8-4-3-7-5-10(11(18)9(7)6-8)17-12(19)13(14,15)16/h3-4,6,10H,2,5H2,1H3,(H,17,19) |
| InChIKey | RMZWAOSHDBGBSY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |