C9H16N4O3 — CID 18519117
N'-[4-(2,5-dioxoimidazolidin-4-yl)butyl]-N-hydroxyethanimidamide (PubChem CID 18519117) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is N'-[4-(2,5-dioxoimidazolidin-4-yl)butyl]-N-hydroxyethanimidamide.
| Compound Name | N'-[4-(2,5-dioxoimidazolidin-4-yl)butyl]-N-hydroxyethanimidamide |
|---|---|
| PubChem CID | 18519117 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | N'-[4-(2,5-dioxoimidazolidin-4-yl)butyl]-N-hydroxyethanimidamide |
| SMILES | C/C(=N\CCCCC1NC(=O)NC1=O)NO |
| InChI | InChI=1S/C9H16N4O3/c1-6(13-16)10-5-3-2-4-7-8(14)12-9(15)11-7/h7,16H,2-5H2,1H3,(H,10,13)(H2,11,12,14,15) |
| InChIKey | GARHXLBFJGGRTB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|