About tripropoxy(3,3,3-trifluoropropyl)silane
tripropoxy(3,3,3-trifluoropropyl)silane (PubChem CID 18519534) has the molecular formula C12H25F3O3Si
and a molecular weight of 302.41 g/mol. Its IUPAC name is tripropoxy(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | tripropoxy(3,3,3-trifluoropropyl)silane |
| PubChem CID | 18519534 |
| Molecular Formula | C12H25F3O3Si |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | tripropoxy(3,3,3-trifluoropropyl)silane |
| SMILES | CCCO[Si](CCC(F)(F)F)(OCCC)OCCC |
| InChI | InChI=1S/C12H25F3O3Si/c1-4-8-16-19(17-9-5-2,18-10-6-3)11-7-12(13,14)15/h4-11H2,1-3H3 |
| InChIKey | ZVPKMEQEIHFILG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tripropoxy(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripropoxy(3,3,3-trifluoropropyl)silane?
The IUPAC name of tripropoxy(3,3,3-trifluoropropyl)silane (CID 18519534) is tripropoxy(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for tripropoxy(3,3,3-trifluoropropyl)silane?
The canonical SMILES for tripropoxy(3,3,3-trifluoropropyl)silane is CCCO[Si](CCC(F)(F)F)(OCCC)OCCC.
What is the InChIKey of tripropoxy(3,3,3-trifluoropropyl)silane?
The InChIKey is ZVPKMEQEIHFILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25F3O3Si/c1-4-8-16-19(17-9-5-2,18-10-6-3)11-7-12(13,14)15/h4-11H2,1-3H3.
What are the key properties of tripropoxy(3,3,3-trifluoropropyl)silane?
tripropoxy(3,3,3-trifluoropropyl)silane has a molecular weight of 302.41 g/mol, XLogP of 4.16, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tripropoxy(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 18519534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).