C10H10N2O4 — CID 18519653
3-ethylpyrrole-2,5-dione;pyrrole-2,5-dione (PubChem CID 18519653) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 3-ethylpyrrole-2,5-dione;pyrrole-2,5-dione.
| Compound Name | 3-ethylpyrrole-2,5-dione;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18519653 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-ethylpyrrole-2,5-dione;pyrrole-2,5-dione |
| SMILES | CCC1=CC(=O)NC1=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C6H7NO2.C4H3NO2/c1-2-4-3-5(8)7-6(4)9;6-3-1-2-4(7)5-3/h3H,2H2,1H3,(H,7,8,9);1-2H,(H,5,6,7) |
| InChIKey | XWFLFMUATPUKOS-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|