C5H7N3O4 — CID 18520329
1-(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 18520329) has the molecular formula C5H7N3O4 and a molecular weight of 173.13 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18520329 |
| Molecular Formula | C5H7N3O4 |
| Molecular Weight | 173.13 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 1-(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCO)c(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O4/c9-2-1-8-4(11)6-3(10)7-5(8)12/h9H,1-2H2,(H2,6,7,10,11,12) |
| InChIKey | ANMAWDWFQHQPFX-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.13 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |