C11H14N2 — CID 18520363
7,8,9,9a,10,10a-hexahydropyrazino[1,2-a]indole (PubChem CID 18520363) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 7,8,9,9a,10,10a-hexahydropyrazino[1,2-a]indole.
| Compound Name | 7,8,9,9a,10,10a-hexahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 18520363 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 7,8,9,9a,10,10a-hexahydropyrazino[1,2-a]indole |
| SMILES | C1=CN2C3=CCCCC3CC2C=N1 |
| InChI | InChI=1S/C11H14N2/c1-2-4-11-9(3-1)7-10-8-12-5-6-13(10)11/h4-6,8-10H,1-3,7H2 |
| InChIKey | IDOLMSWHVAKNLQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |