About 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one
9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 18520478) has the molecular formula C11H9FN2O
and a molecular weight of 204.20 g/mol. Its IUPAC name is 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
Molecular Properties
| Compound Name | 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| PubChem CID | 18520478 |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | O=C1NCCn2c1cc1c(F)cccc12 |
| InChI | InChI=1S/C11H9FN2O/c12-8-2-1-3-9-7(8)6-10-11(15)13-4-5-14(9)10/h1-3,6H,4-5H2,(H,13,15) |
| InChIKey | ORVGCOMTRKDMJF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The IUPAC name of 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (CID 18520478) is 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
What is the SMILES notation for 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The canonical SMILES for 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is O=C1NCCn2c1cc1c(F)cccc12.
What is the InChIKey of 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The InChIKey is ORVGCOMTRKDMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O/c12-8-2-1-3-9-7(8)6-10-11(15)13-4-5-14(9)10/h1-3,6H,4-5H2,(H,13,15).
What are the key properties of 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one has a molecular weight of 204.20 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is sourced from PubChem (CID 18520478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).