C18H18ClN5O2 — CID 18520504
1-[4-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]-5-ethylpyrazole-4-carbaldehyde (PubChem CID 18520504) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 1-[4-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]-5-ethylpyrazole-4-carbaldehyde.
| Compound Name | 1-[4-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]-5-ethylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 18520504 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[4-chloro-6-[(4-methoxyphenyl)methylamino]pyrimidin-2-yl]-5-ethylpyrazole-4-carbaldehyde |
| SMILES | CCc1c(C=O)cnn1-c1nc(Cl)cc(NCc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C18H18ClN5O2/c1-3-15-13(11-25)10-21-24(15)18-22-16(19)8-17(23-18)20-9-12-4-6-14(26-2)7-5-12/h4-8,10-11H,3,9H2,1-2H3,(H,20,22,23) |
| InChIKey | VUGCDCJOZQSEIJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|