C11H14N2O — CID 18520561
1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine (PubChem CID 18520561) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine.
| Compound Name | 1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 18520561 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazine |
| SMILES | c1ccc2c(c1)OCC1CNCCN21 |
| InChI | InChI=1S/C11H14N2O/c1-2-4-11-10(3-1)13-6-5-12-7-9(13)8-14-11/h1-4,9,12H,5-8H2 |
| InChIKey | JZKFDTSLBOMGLJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |