About 1-fluoro-2,3-dimethylcyclopropane
1-fluoro-2,3-dimethylcyclopropane (PubChem CID 18520884) has the molecular formula C5H9F
and a molecular weight of 88.13 g/mol. Its IUPAC name is 1-fluoro-2,3-dimethylcyclopropane.
Molecular Properties
| Compound Name | 1-fluoro-2,3-dimethylcyclopropane |
| PubChem CID | 18520884 |
| Molecular Formula | C5H9F |
| Molecular Weight | 88.13 g/mol |
| Exact Mass | 88.07 |
| IUPAC Name | 1-fluoro-2,3-dimethylcyclopropane |
| SMILES | CC1C(C)C1F |
| InChI | InChI=1S/C5H9F/c1-3-4(2)5(3)6/h3-5H,1-2H3 |
| InChIKey | REYLNXBSMHOQSQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.13 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-2,3-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,3-dimethylcyclopropane?
The IUPAC name of 1-fluoro-2,3-dimethylcyclopropane (CID 18520884) is 1-fluoro-2,3-dimethylcyclopropane.
What is the SMILES notation for 1-fluoro-2,3-dimethylcyclopropane?
The canonical SMILES for 1-fluoro-2,3-dimethylcyclopropane is CC1C(C)C1F.
What is the InChIKey of 1-fluoro-2,3-dimethylcyclopropane?
The InChIKey is REYLNXBSMHOQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F/c1-3-4(2)5(3)6/h3-5H,1-2H3.
What are the key properties of 1-fluoro-2,3-dimethylcyclopropane?
1-fluoro-2,3-dimethylcyclopropane has a molecular weight of 88.13 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,3-dimethylcyclopropane is sourced from PubChem (CID 18520884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).