C7H4F10 — CID 18520906
1,1,2,2-tetrafluoro-3,3-bis(trifluoromethyl)cyclopentane (PubChem CID 18520906) has the molecular formula C7H4F10 and a molecular weight of 278.09 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3,3-bis(trifluoromethyl)cyclopentane.
| Compound Name | 1,1,2,2-tetrafluoro-3,3-bis(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 18520906 |
| Molecular Formula | C7H4F10 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3,3-bis(trifluoromethyl)cyclopentane |
| SMILES | FC(F)(F)C1(C(F)(F)F)CCC(F)(F)C1(F)F |
| InChI | InChI=1S/C7H4F10/c8-4(9)2-1-3(5(4,10)11,6(12,13)14)7(15,16)17/h1-2H2 |
| InChIKey | RKNMPNYDNFLZRL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|