About 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene
3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene (PubChem CID 18520921) has the molecular formula C7H4F8
and a molecular weight of 240.09 g/mol. Its IUPAC name is 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene.
Molecular Properties
| Compound Name | 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene |
| PubChem CID | 18520921 |
| Molecular Formula | C7H4F8 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(F)(F)CC1 |
| InChI | InChI=1S/C7H4F8/c8-5(9)2-1-3(6(10,11)12)4(5)7(13,14)15/h1-2H2 |
| InChIKey | UVNXHTDZZSBLJF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene?
The IUPAC name of 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene (CID 18520921) is 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene.
What is the SMILES notation for 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene?
The canonical SMILES for 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene is FC(F)(F)C1=C(C(F)(F)F)C(F)(F)CC1.
What is the InChIKey of 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene?
The InChIKey is UVNXHTDZZSBLJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F8/c8-5(9)2-1-3(6(10,11)12)4(5)7(13,14)15/h1-2H2.
What are the key properties of 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene?
3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene has a molecular weight of 240.09 g/mol, XLogP of 3.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1,2-bis(trifluoromethyl)cyclopentene is sourced from PubChem (CID 18520921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).