About (Z)-1,3-difluoro-2-methylprop-1-ene
(Z)-1,3-difluoro-2-methylprop-1-ene (PubChem CID 18520934) has the molecular formula C4H6F2
and a molecular weight of 92.09 g/mol. Its IUPAC name is (Z)-1,3-difluoro-2-methylprop-1-ene.
Molecular Properties
| Compound Name | (Z)-1,3-difluoro-2-methylprop-1-ene |
| PubChem CID | 18520934 |
| Molecular Formula | C4H6F2 |
| Molecular Weight | 92.09 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | (Z)-1,3-difluoro-2-methylprop-1-ene |
| SMILES | C/C(=C/F)CF |
| InChI | InChI=1S/C4H6F2/c1-4(2-5)3-6/h2H,3H2,1H3/b4-2- |
| InChIKey | CNFPGPIJQQCZMQ-RQOWECAXSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.09 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (Z)-1,3-difluoro-2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,3-difluoro-2-methylprop-1-ene?
The IUPAC name of (Z)-1,3-difluoro-2-methylprop-1-ene (CID 18520934) is (Z)-1,3-difluoro-2-methylprop-1-ene.
What is the SMILES notation for (Z)-1,3-difluoro-2-methylprop-1-ene?
The canonical SMILES for (Z)-1,3-difluoro-2-methylprop-1-ene is C/C(=C/F)CF.
What is the InChIKey of (Z)-1,3-difluoro-2-methylprop-1-ene?
The InChIKey is CNFPGPIJQQCZMQ-RQOWECAXSA-N. The full InChI is InChI=1S/C4H6F2/c1-4(2-5)3-6/h2H,3H2,1H3/b4-2-.
What are the key properties of (Z)-1,3-difluoro-2-methylprop-1-ene?
(Z)-1,3-difluoro-2-methylprop-1-ene has a molecular weight of 92.09 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,3-difluoro-2-methylprop-1-ene is sourced from PubChem (CID 18520934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).