C4H6F2 — CID 18520934
(Z)-1,3-difluoro-2-methylprop-1-ene (PubChem CID 18520934) has the molecular formula C4H6F2 and a molecular weight of 92.09 g/mol. Its IUPAC name is (Z)-1,3-difluoro-2-methylprop-1-ene.
| Compound Name | (Z)-1,3-difluoro-2-methylprop-1-ene |
|---|---|
| PubChem CID | 18520934 |
| Molecular Formula | C4H6F2 |
| Molecular Weight | 92.09 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | (Z)-1,3-difluoro-2-methylprop-1-ene |
| SMILES | C/C(=C/F)CF |
| InChI | InChI=1S/C4H6F2/c1-4(2-5)3-6/h2H,3H2,1H3/b4-2- |
| InChIKey | CNFPGPIJQQCZMQ-RQOWECAXSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.09 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |