C3H12N6 — CID 18521007
1,3,5-triazinane-1,3,5-triamine (PubChem CID 18521007) has the molecular formula C3H12N6 and a molecular weight of 132.17 g/mol. Its IUPAC name is 1,3,5-triazinane-1,3,5-triamine.
| Compound Name | 1,3,5-triazinane-1,3,5-triamine |
|---|---|
| PubChem CID | 18521007 |
| Molecular Formula | C3H12N6 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | 1,3,5-triazinane-1,3,5-triamine |
| SMILES | NN1CN(N)CN(N)C1 |
| InChI | InChI=1S/C3H12N6/c4-7-1-8(5)3-9(6)2-7/h1-6H2 |
| InChIKey | DXHSASRDAUZUCC-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|