About 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline
4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline (PubChem CID 18521115) has the molecular formula C18H19F2NO
and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline |
| PubChem CID | 18521115 |
| Molecular Formula | C18H19F2NO |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline |
| SMILES | CCCCOc1ccc(/C=C/c2cc(F)c(N)c(F)c2)cc1 |
| InChI | InChI=1S/C18H19F2NO/c1-2-3-10-22-15-8-6-13(7-9-15)4-5-14-11-16(19)18(21)17(20)12-14/h4-9,11-12H,2-3,10,21H2,1H3/b5-4+ |
| InChIKey | KUGJGQKUJOYDRX-SNAWJCMRSA-N |
| XLogP | 4.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline?
The IUPAC name of 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline (CID 18521115) is 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline.
What is the SMILES notation for 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline?
The canonical SMILES for 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline is CCCCOc1ccc(/C=C/c2cc(F)c(N)c(F)c2)cc1.
What is the InChIKey of 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline?
The InChIKey is KUGJGQKUJOYDRX-SNAWJCMRSA-N. The full InChI is InChI=1S/C18H19F2NO/c1-2-3-10-22-15-8-6-13(7-9-15)4-5-14-11-16(19)18(21)17(20)12-14/h4-9,11-12H,2-3,10,21H2,1H3/b5-4+.
What are the key properties of 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline?
4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline has a molecular weight of 303.35 g/mol, XLogP of 4.90, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(4-butoxyphenyl)ethenyl]-2,6-difluoroaniline is sourced from PubChem (CID 18521115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).