About 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate
1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate (PubChem CID 18521153) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate |
| PubChem CID | 18521153 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate |
| SMILES | CN1C=CC(C(=O)O)=CC1.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C7H9NO2.C5H11NO2/c1-8-4-2-6(3-5-8)7(9)10;1-6(2,3)4-5(7)8/h2-4H,5H2,1H3,(H,9,10);4H2,1-3H3 |
| InChIKey | QNDWJWIMSDYZAN-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate?
The IUPAC name of 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate (CID 18521153) is 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate?
The canonical SMILES for 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate is CN1C=CC(C(=O)O)=CC1.C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate?
The InChIKey is QNDWJWIMSDYZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.C5H11NO2/c1-8-4-2-6(3-5-8)7(9)10;1-6(2,3)4-5(7)8/h2-4H,5H2,1H3,(H,9,10);4H2,1-3H3.
What are the key properties of 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate?
1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate has a molecular weight of 256.30 g/mol, XLogP of -1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-pyridine-4-carboxylic acid;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 18521153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).