C14H26N2O — CID 18521170
(E)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enamide (PubChem CID 18521170) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (E)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enamide.
| Compound Name | (E)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enamide |
|---|---|
| PubChem CID | 18521170 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (E)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C14H26N2O/c1-7-8-12(17)15-11-9-13(2,3)16(6)14(4,5)10-11/h7-8,11H,9-10H2,1-6H3,(H,15,17)/b8-7+ |
| InChIKey | XJCMOIYMAUJTEV-BQYQJAHWSA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|