About 3-methylsulfinylphenol
3-methylsulfinylphenol (PubChem CID 18521377) has the molecular formula C7H8O2S
and a molecular weight of 156.21 g/mol. Its IUPAC name is 3-methylsulfinylphenol.
Molecular Properties
| Compound Name | 3-methylsulfinylphenol |
| PubChem CID | 18521377 |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 3-methylsulfinylphenol |
| SMILES | CS(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C7H8O2S/c1-10(9)7-4-2-3-6(8)5-7/h2-5,8H,1H3 |
| InChIKey | NYEJOIGPFQJXFY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylsulfinylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfinylphenol?
The IUPAC name of 3-methylsulfinylphenol (CID 18521377) is 3-methylsulfinylphenol.
What is the SMILES notation for 3-methylsulfinylphenol?
The canonical SMILES for 3-methylsulfinylphenol is CS(=O)c1cccc(O)c1.
What is the InChIKey of 3-methylsulfinylphenol?
The InChIKey is NYEJOIGPFQJXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S/c1-10(9)7-4-2-3-6(8)5-7/h2-5,8H,1H3.
What are the key properties of 3-methylsulfinylphenol?
3-methylsulfinylphenol has a molecular weight of 156.21 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfinylphenol is sourced from PubChem (CID 18521377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).