C22H23N3O4S — CID 18521775
5-[[4-[1-(5-hydroxy-4,6,7-trimethyl-1H-benzimidazol-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 18521775) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 5-[[4-[1-(5-hydroxy-4,6,7-trimethyl-1H-benzimidazol-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[1-(5-hydroxy-4,6,7-trimethyl-1H-benzimidazol-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18521775 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 5-[[4-[1-(5-hydroxy-4,6,7-trimethyl-1H-benzimidazol-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1c(O)c(C)c2nc(C(C)Oc3ccc(CC4SC(=O)NC4=O)cc3)[nH]c2c1C |
| InChI | InChI=1S/C22H23N3O4S/c1-10-11(2)19(26)12(3)18-17(10)23-20(24-18)13(4)29-15-7-5-14(6-8-15)9-16-21(27)25-22(28)30-16/h5-8,13,16,26H,9H2,1-4H3,(H,23,24)(H,25,27,28) |
| InChIKey | QPZSKTVLVJNVLT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|