C29H26F2N4O3S — CID 18521801
benzyl 1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidine-4-carboxylate (PubChem CID 18521801) has the molecular formula C29H26F2N4O3S and a molecular weight of 548.62 g/mol. Its IUPAC name is benzyl 1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidine-4-carboxylate.
| Compound Name | benzyl 1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18521801 |
| Molecular Formula | C29H26F2N4O3S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | benzyl 1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidine-4-carboxylate |
| SMILES | Nc1nc(Nc2ccc(N3CCC(C(=O)OCc4ccccc4)CC3)cc2)sc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C29H26F2N4O3S/c30-22-7-4-8-23(31)24(22)25(36)26-27(32)34-29(39-26)33-20-9-11-21(12-10-20)35-15-13-19(14-16-35)28(37)38-17-18-5-2-1-3-6-18/h1-12,19H,13-17,32H2,(H,33,34) |
| InChIKey | VLOBVRVECPMWOR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|