C25H26F3N5O3S — CID 18521869
tert-butyl 4-[4-[[4-amino-5-(2,4,6-trifluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 18521869) has the molecular formula C25H26F3N5O3S and a molecular weight of 533.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-amino-5-(2,4,6-trifluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-amino-5-(2,4,6-trifluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18521869 |
| Molecular Formula | C25H26F3N5O3S |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | tert-butyl 4-[4-[[4-amino-5-(2,4,6-trifluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3nc(N)c(C(=O)c4c(F)cc(F)cc4F)s3)cc2)CC1 |
| InChI | InChI=1S/C25H26F3N5O3S/c1-25(2,3)36-24(35)33-10-8-32(9-11-33)16-6-4-15(5-7-16)30-23-31-22(29)21(37-23)20(34)19-17(27)12-14(26)13-18(19)28/h4-7,12-13H,8-11,29H2,1-3H3,(H,30,31) |
| InChIKey | LORCKFPWKRKGLV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|