C25H27F2N5O3S — CID 18521886
tert-butyl 4-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 18521886) has the molecular formula C25H27F2N5O3S and a molecular weight of 515.59 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18521886 |
| Molecular Formula | C25H27F2N5O3S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | tert-butyl 4-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3nc(N)c(C(=O)c4c(F)cccc4F)s3)cc2)CC1 |
| InChI | InChI=1S/C25H27F2N5O3S/c1-25(2,3)35-24(34)32-13-11-31(12-14-32)16-9-7-15(8-10-16)29-23-30-22(28)21(36-23)20(33)19-17(26)5-4-6-18(19)27/h4-10H,11-14,28H2,1-3H3,(H,29,30) |
| InChIKey | LSCMLXOVDHNIDO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|