About (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate
(2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate (PubChem CID 18522463) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate.
Molecular Properties
| Compound Name | (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate |
| PubChem CID | 18522463 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate |
| SMILES | CC(=O)OC1C=C(C)OC(C)O1 |
| InChI | InChI=1S/C8H12O4/c1-5-4-8(11-6(2)9)12-7(3)10-5/h4,7-8H,1-3H3 |
| InChIKey | DMZDMVJQIKSCLK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate?
The IUPAC name of (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate (CID 18522463) is (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate.
What is the SMILES notation for (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate?
The canonical SMILES for (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate is CC(=O)OC1C=C(C)OC(C)O1.
What is the InChIKey of (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate?
The InChIKey is DMZDMVJQIKSCLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-5-4-8(11-6(2)9)12-7(3)10-5/h4,7-8H,1-3H3.
What are the key properties of (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate?
(2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate has a molecular weight of 172.18 g/mol, XLogP of 1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethyl-4H-1,3-dioxin-4-yl) acetate is sourced from PubChem (CID 18522463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).