C11H21NO3 — CID 18522538
1-hydroxy-2,2,7,7-tetramethylazepane-4-carboxylic acid (PubChem CID 18522538) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-hydroxy-2,2,7,7-tetramethylazepane-4-carboxylic acid.
| Compound Name | 1-hydroxy-2,2,7,7-tetramethylazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 18522538 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-hydroxy-2,2,7,7-tetramethylazepane-4-carboxylic acid |
| SMILES | CC1(C)CCC(C(=O)O)CC(C)(C)N1O |
| InChI | InChI=1S/C11H21NO3/c1-10(2)6-5-8(9(13)14)7-11(3,4)12(10)15/h8,15H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | HQPYDDFUFSRJFS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |