About 1-phenylethenamine
1-phenylethenamine (PubChem CID 18522818) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 1-phenylethenamine.
Molecular Properties
| Compound Name | 1-phenylethenamine |
| PubChem CID | 18522818 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 1-phenylethenamine |
| SMILES | C=C(N)c1ccccc1 |
| InChI | InChI=1S/C8H9N/c1-7(9)8-5-3-2-4-6-8/h2-6H,1,9H2 |
| InChIKey | FUXMOFPWLDVQTM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethenamine?
The IUPAC name of 1-phenylethenamine (CID 18522818) is 1-phenylethenamine.
What is the SMILES notation for 1-phenylethenamine?
The canonical SMILES for 1-phenylethenamine is C=C(N)c1ccccc1.
What is the InChIKey of 1-phenylethenamine?
The InChIKey is FUXMOFPWLDVQTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-7(9)8-5-3-2-4-6-8/h2-6H,1,9H2.
What are the key properties of 1-phenylethenamine?
1-phenylethenamine has a molecular weight of 119.17 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethenamine is sourced from PubChem (CID 18522818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).