C17H28O3 — CID 18523712
(3S)-3-hydroxy-3-[(1R,2S,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]propanoic acid (PubChem CID 18523712) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(1R,2S,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]propanoic acid.
| Compound Name | (3S)-3-hydroxy-3-[(1R,2S,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]propanoic acid |
|---|---|
| PubChem CID | 18523712 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (3S)-3-hydroxy-3-[(1R,2S,7S,8S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]propanoic acid |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]([C@@H](O)CC(=O)O)[C@H]3CC[C@@H]2[C@H]31 |
| InChI | InChI=1S/C17H28O3/c1-16(2)7-4-8-17(3)11-6-5-10(14(11)16)15(17)12(18)9-13(19)20/h10-12,14-15,18H,4-9H2,1-3H3,(H,19,20)/t10-,11+,12-,14-,15+,17-/m0/s1 |
| InChIKey | RLQFTWPXIKWKJH-ROVOPSCPSA-N |
| XLogP | 3.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |