About 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one
3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 18524425) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one |
| PubChem CID | 18524425 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | COc1ccc(CCNCc2cc3ccc(C)cc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C21H24N2O3/c1-14-4-6-16-12-17(21(24)23-18(16)10-14)13-22-9-8-15-5-7-19(25-2)20(11-15)26-3/h4-7,10-12,22H,8-9,13H2,1-3H3,(H,23,24) |
| InChIKey | DQFXNHBKURRHGQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one?
The IUPAC name of 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one (CID 18524425) is 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one.
What is the SMILES notation for 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one?
The canonical SMILES for 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one is COc1ccc(CCNCc2cc3ccc(C)cc3[nH]c2=O)cc1OC.
What is the InChIKey of 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one?
The InChIKey is DQFXNHBKURRHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c1-14-4-6-16-12-17(21(24)23-18(16)10-14)13-22-9-8-15-5-7-19(25-2)20(11-15)26-3/h4-7,10-12,22H,8-9,13H2,1-3H3,(H,23,24).
What are the key properties of 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one?
3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one has a molecular weight of 352.43 g/mol, XLogP of 3.19, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-7-methyl-1H-quinolin-2-one is sourced from PubChem (CID 18524425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).