C15H11ClFN3 — CID 18524600
2-chloro-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 18524600) has the molecular formula C15H11ClFN3 and a molecular weight of 287.73 g/mol. Its IUPAC name is 2-chloro-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-chloro-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 18524600 |
| Molecular Formula | C15H11ClFN3 |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-chloro-11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | Fc1cccc(-c2cc3nc4c(c(Cl)n3n2)CCC4)c1 |
| InChI | InChI=1S/C15H11ClFN3/c16-15-11-5-2-6-12(11)18-14-8-13(19-20(14)15)9-3-1-4-10(17)7-9/h1,3-4,7-8H,2,5-6H2 |
| InChIKey | PHBNJXGYMJQZKZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |