C17H28I2N2O — CID 18525
4-methyl-4-[3-(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)propyl]morpholin-4-ium diiodide (PubChem CID 18525) has the molecular formula C17H28I2N2O and a molecular weight of 530.23 g/mol. Its IUPAC name is 4-methyl-4-[3-(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)propyl]morpholin-4-ium diiodide.
| Compound Name | 4-methyl-4-[3-(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)propyl]morpholin-4-ium diiodide |
|---|---|
| PubChem CID | 18525 |
| Molecular Formula | C17H28I2N2O |
| Molecular Weight | 530.23 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 4-methyl-4-[3-(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)propyl]morpholin-4-ium diiodide |
| SMILES | C[N+]1(CCC[N+]2(C)Cc3ccccc3C2)CCOCC1.[I-].[I-] |
| InChI | InChI=1S/C17H28N2O.2HI/c1-18(10-12-20-13-11-18)8-5-9-19(2)14-16-6-3-4-7-17(16)15-19;;/h3-4,6-7H,5,8-15H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | LCGNRGMILDAIBN-UHFFFAOYSA-L |
| XLogP | -3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.23 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|