About N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide
N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide (PubChem CID 18525555) has the molecular formula C23H25N5O2
and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide |
| PubChem CID | 18525555 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide |
| SMILES | CCN(CCCNC(=O)Cn1cnc2c([nH]c3ccccc32)c1=O)c1ccccc1 |
| InChI | InChI=1S/C23H25N5O2/c1-2-27(17-9-4-3-5-10-17)14-8-13-24-20(29)15-28-16-25-21-18-11-6-7-12-19(18)26-22(21)23(28)30/h3-7,9-12,16,26H,2,8,13-15H2,1H3,(H,24,29) |
| InChIKey | ILUNONRQGMDDJT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide?
The IUPAC name of N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide (CID 18525555) is N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide.
What is the SMILES notation for N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide?
The canonical SMILES for N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide is CCN(CCCNC(=O)Cn1cnc2c([nH]c3ccccc32)c1=O)c1ccccc1.
What is the InChIKey of N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide?
The InChIKey is ILUNONRQGMDDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O2/c1-2-27(17-9-4-3-5-10-17)14-8-13-24-20(29)15-28-16-25-21-18-11-6-7-12-19(18)26-22(21)23(28)30/h3-7,9-12,16,26H,2,8,13-15H2,1H3,(H,24,29).
What are the key properties of N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide?
N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide has a molecular weight of 403.49 g/mol, XLogP of 2.91, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(N-ethylanilino)propyl]-2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)acetamide is sourced from PubChem (CID 18525555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).