About 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide
2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 18525561) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide |
| PubChem CID | 18525561 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cn1cnc2c([nH]c3ccccc32)c1=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H20N4O2/c26-18(22-12-6-9-15-7-2-1-3-8-15)13-25-14-23-19-16-10-4-5-11-17(16)24-20(19)21(25)27/h1-5,7-8,10-11,14,24H,6,9,12-13H2,(H,22,26) |
| InChIKey | HIWUBJARNIZCMF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide?
The IUPAC name of 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide (CID 18525561) is 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide.
What is the SMILES notation for 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide?
The canonical SMILES for 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide is O=C(Cn1cnc2c([nH]c3ccccc32)c1=O)NCCCc1ccccc1.
What is the InChIKey of 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide?
The InChIKey is HIWUBJARNIZCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O2/c26-18(22-12-6-9-15-7-2-1-3-8-15)13-25-14-23-19-16-10-4-5-11-17(16)24-20(19)21(25)27/h1-5,7-8,10-11,14,24H,6,9,12-13H2,(H,22,26).
What are the key properties of 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide?
2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide has a molecular weight of 360.42 g/mol, XLogP of 2.63, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(3-phenylpropyl)acetamide is sourced from PubChem (CID 18525561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).