C11H15NO — CID 18525713
(2,2-dimethyl-3H-1-benzofuran-7-yl)methanamine (PubChem CID 18525713) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl)methanamine.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl)methanamine |
|---|---|
| PubChem CID | 18525713 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl)methanamine |
| SMILES | CC1(C)Cc2cccc(CN)c2O1 |
| InChI | InChI=1S/C11H15NO/c1-11(2)6-8-4-3-5-9(7-12)10(8)13-11/h3-5H,6-7,12H2,1-2H3 |
| InChIKey | BQEPNISHAAOSFF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |