About 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile
5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile (PubChem CID 18525891) has the molecular formula C7H4BrNO2S
and a molecular weight of 246.08 g/mol. Its IUPAC name is 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile.
Molecular Properties
| Compound Name | 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile |
| PubChem CID | 18525891 |
| Molecular Formula | C7H4BrNO2S |
| Molecular Weight | 246.08 g/mol |
| Exact Mass | 244.91 |
| IUPAC Name | 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile |
| SMILES | N#Cc1sc(Br)c2c1OCCO2 |
| InChI | InChI=1S/C7H4BrNO2S/c8-7-6-5(4(3-9)12-7)10-1-2-11-6/h1-2H2 |
| InChIKey | CNYIRGSQBVJHBW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile?
The IUPAC name of 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile (CID 18525891) is 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile.
What is the SMILES notation for 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile?
The canonical SMILES for 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile is N#Cc1sc(Br)c2c1OCCO2.
What is the InChIKey of 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile?
The InChIKey is CNYIRGSQBVJHBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNO2S/c8-7-6-5(4(3-9)12-7)10-1-2-11-6/h1-2H2.
What are the key properties of 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile?
5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile has a molecular weight of 246.08 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-7-carbonitrile is sourced from PubChem (CID 18525891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).