About [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol
[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol (PubChem CID 18525904) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol |
| PubChem CID | 18525904 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol |
| SMILES | CN1CCCN(c2ccc(CO)cc2)CC1 |
| InChI | InChI=1S/C13H20N2O/c1-14-7-2-8-15(10-9-14)13-5-3-12(11-16)4-6-13/h3-6,16H,2,7-11H2,1H3 |
| InChIKey | DZPOSPVFLJMLQF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol?
The IUPAC name of [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol (CID 18525904) is [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol.
What is the SMILES notation for [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol?
The canonical SMILES for [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol is CN1CCCN(c2ccc(CO)cc2)CC1.
What is the InChIKey of [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol?
The InChIKey is DZPOSPVFLJMLQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-14-7-2-8-15(10-9-14)13-5-3-12(11-16)4-6-13/h3-6,16H,2,7-11H2,1H3.
What are the key properties of [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol?
[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol has a molecular weight of 220.32 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanol is sourced from PubChem (CID 18525904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).